ChemNet > CAS > 465514-69-6 3-[2-(3-chlorophenyl)acetyl]benzonitrile
465514-69-6 3-[2-(3-chlorophenyl)acetyl]benzonitrile
| Ürün Adı |
3-[2-(3-chlorophenyl)acetyl]benzonitrile |
| Eş anlamlı |
3-[(3-chlorophenyl)acetyl]benzonitrile |
| Moleküler Formülü |
C15H10ClNO |
| Molekül Ağırlığı |
255.699 |
| InChI |
InChI=1/C15H10ClNO/c16-14-6-2-3-11(8-14)9-15(18)13-5-1-4-12(7-13)10-17/h1-8H,9H2 |
| CAS kayıt numarası |
465514-69-6 |
| Moleküler Yapısı |
![465514-69-6 3-[2-(3-chlorophenyl)acetyl]benzonitrile](https://images-a.chemnet.com/suppliers/chembase/849/116849.gif)
|
| Yoğunluk |
1.27g/cm3 |
| Ergime noktası |
87.5℃ |
| Kaynama noktası |
416.5°C at 760 mmHg |
| Kırılma indisi |
1.615 |
| Alevlenme noktası |
205.7°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|
